C13H12F3NO5S — CID 10020821
[(2R)-2-(1,3-dioxoisoindol-2-yl)butyl] trifluoromethanesulfonate (PubChem CID 10020821) has the molecular formula C13H12F3NO5S and a molecular weight of 351.30 g/mol. Its IUPAC name is [(2R)-2-(1,3-dioxoisoindol-2-yl)butyl] trifluoromethanesulfonate.
| Compound Name | [(2R)-2-(1,3-dioxoisoindol-2-yl)butyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10020821 |
| Molecular Formula | C13H12F3NO5S |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | [(2R)-2-(1,3-dioxoisoindol-2-yl)butyl] trifluoromethanesulfonate |
| SMILES | CC[C@H](COS(=O)(=O)C(F)(F)F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H12F3NO5S/c1-2-8(7-22-23(20,21)13(14,15)16)17-11(18)9-5-3-4-6-10(9)12(17)19/h3-6,8H,2,7H2,1H3/t8-/m1/s1 |
| InChIKey | ZPQRHQUQJDHINA-MRVPVSSYSA-N |
| XLogP | 1.93 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|