C10H6F3NO4S — CID 21136372
(1-methylidene-3-oxoisoindol-2-yl) trifluoromethanesulfonate (PubChem CID 21136372) has the molecular formula C10H6F3NO4S and a molecular weight of 293.22 g/mol. Its IUPAC name is (1-methylidene-3-oxoisoindol-2-yl) trifluoromethanesulfonate.
| Compound Name | (1-methylidene-3-oxoisoindol-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 21136372 |
| Molecular Formula | C10H6F3NO4S |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | (1-methylidene-3-oxoisoindol-2-yl) trifluoromethanesulfonate |
| SMILES | C=C1c2ccccc2C(=O)N1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H6F3NO4S/c1-6-7-4-2-3-5-8(7)9(15)14(6)18-19(16,17)10(11,12)13/h2-5H,1H2 |
| InChIKey | XXEXOUDMSDFBJE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|