C15H8F3NO3 — CID 133057511
2-[2-(trifluoromethyl)phenoxy]isoindole-1,3-dione (PubChem CID 133057511) has the molecular formula C15H8F3NO3 and a molecular weight of 307.23 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)phenoxy]isoindole-1,3-dione.
| Compound Name | 2-[2-(trifluoromethyl)phenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 133057511 |
| Molecular Formula | C15H8F3NO3 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-[2-(trifluoromethyl)phenoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H8F3NO3/c16-15(17,18)11-7-3-4-8-12(11)22-19-13(20)9-5-1-2-6-10(9)14(19)21/h1-8H |
| InChIKey | LSWRTXQBBFDFGW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|