C17H24F3NO3 — CID 175276627
tert-butyl formate;1-[2-(trifluoromethyl)phenoxy]piperidine (PubChem CID 175276627) has the molecular formula C17H24F3NO3 and a molecular weight of 347.38 g/mol. Its IUPAC name is tert-butyl formate;1-[2-(trifluoromethyl)phenoxy]piperidine.
| Compound Name | tert-butyl formate;1-[2-(trifluoromethyl)phenoxy]piperidine |
|---|---|
| PubChem CID | 175276627 |
| Molecular Formula | C17H24F3NO3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | tert-butyl formate;1-[2-(trifluoromethyl)phenoxy]piperidine |
| SMILES | CC(C)(C)OC=O.FC(F)(F)c1ccccc1ON1CCCCC1 |
| InChI | InChI=1S/C12H14F3NO.C5H10O2/c13-12(14,15)10-6-2-3-7-11(10)17-16-8-4-1-5-9-16;1-5(2,3)7-4-6/h2-3,6-7H,1,4-5,8-9H2;4H,1-3H3 |
| InChIKey | JRKHAQLAMFUNNP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|