C16H8F3NO7S — CID 176878528
[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-5-yl] prop-2-enoate (PubChem CID 176878528) has the molecular formula C16H8F3NO7S and a molecular weight of 415.30 g/mol. Its IUPAC name is [1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-5-yl] prop-2-enoate.
| Compound Name | [1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-5-yl] prop-2-enoate |
|---|---|
| PubChem CID | 176878528 |
| Molecular Formula | C16H8F3NO7S |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | [1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-5-yl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C16H8F3NO7S/c1-2-12(21)26-9-6-8-4-3-5-10-13(8)11(7-9)15(23)20(14(10)22)27-28(24,25)16(17,18)19/h2-7H,1H2 |
| InChIKey | RZBBBELDIXNMHS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|