C17H14F3NO6SU — CID 162573766
(1,3-dioxo-5H-benzo[de]isoquinolin-5-id-2-yl) trifluoromethanesulfonate;ethoxyethane;uranium(2+) (PubChem CID 162573766) has the molecular formula C17H14F3NO6SU and a molecular weight of 655.39 g/mol. Its IUPAC name is (1,3-dioxo-5H-benzo[de]isoquinolin-5-id-2-yl) trifluoromethanesulfonate;ethoxyethane;uranium(2+).
| Compound Name | (1,3-dioxo-5H-benzo[de]isoquinolin-5-id-2-yl) trifluoromethanesulfonate;ethoxyethane;uranium(2+) |
|---|---|
| PubChem CID | 162573766 |
| Molecular Formula | C17H14F3NO6SU |
| Molecular Weight | 655.39 g/mol |
| Exact Mass | 655.10 |
| IUPAC Name | (1,3-dioxo-5H-benzo[de]isoquinolin-5-id-2-yl) trifluoromethanesulfonate;ethoxyethane;uranium(2+) |
| SMILES | O=C1c2c[c-]cc3cccc(c23)C(=O)N1OS(=O)(=O)C(F)(F)F.[CH2-]COCC.[U+2] |
| InChI | InChI=1S/C13H5F3NO5S.C4H9O.U/c14-13(15,16)23(20,21)22-17-11(18)8-5-1-3-7-4-2-6-9(10(7)8)12(17)19;1-3-5-4-2;/h1,3-6H;1,3-4H2,2H3;/q2*-1;+2 |
| InChIKey | YJOOUIIBMLOUKK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|