C26H20FNO5S — CID 175148952
(1,3-dioxobenzo[de]isoquinolin-2-yl) 1-fluoro-1-naphthalen-1-ylbutane-1-sulfonate (PubChem CID 175148952) has the molecular formula C26H20FNO5S and a molecular weight of 477.51 g/mol. Its IUPAC name is (1,3-dioxobenzo[de]isoquinolin-2-yl) 1-fluoro-1-naphthalen-1-ylbutane-1-sulfonate.
| Compound Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) 1-fluoro-1-naphthalen-1-ylbutane-1-sulfonate |
|---|---|
| PubChem CID | 175148952 |
| Molecular Formula | C26H20FNO5S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) 1-fluoro-1-naphthalen-1-ylbutane-1-sulfonate |
| SMILES | CCCC(F)(c1cccc2ccccc12)S(=O)(=O)ON1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C26H20FNO5S/c1-2-16-26(27,22-15-7-9-17-8-3-4-12-19(17)22)34(31,32)33-28-24(29)20-13-5-10-18-11-6-14-21(23(18)20)25(28)30/h3-15H,2,16H2,1H3 |
| InChIKey | GKOJZLJKVXLKMS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|