C19H16F3NO8S — CID 142376906
[5-(2-methylbutan-2-yloxycarbonyloxy)-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate (PubChem CID 142376906) has the molecular formula C19H16F3NO8S and a molecular weight of 475.40 g/mol. Its IUPAC name is [5-(2-methylbutan-2-yloxycarbonyloxy)-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [5-(2-methylbutan-2-yloxycarbonyloxy)-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142376906 |
| Molecular Formula | C19H16F3NO8S |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | [5-(2-methylbutan-2-yloxycarbonyloxy)-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
| SMILES | CCC(C)(C)OC(=O)Oc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C19H16F3NO8S/c1-4-18(2,3)30-17(26)29-11-8-10-6-5-7-12-14(10)13(9-11)16(25)23(15(12)24)31-32(27,28)19(20,21)22/h5-9H,4H2,1-3H3 |
| InChIKey | OLHUTFDXDUHTCV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|