C16H12F3NO4S — CID 129270765
5-propoxy-2-(trifluoromethylsulfanyloxy)benzo[de]isoquinoline-1,3-dione (PubChem CID 129270765) has the molecular formula C16H12F3NO4S and a molecular weight of 371.34 g/mol. Its IUPAC name is 5-propoxy-2-(trifluoromethylsulfanyloxy)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 5-propoxy-2-(trifluoromethylsulfanyloxy)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 129270765 |
| Molecular Formula | C16H12F3NO4S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 5-propoxy-2-(trifluoromethylsulfanyloxy)benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCOc1cc2c3c(cccc3c1)C(=O)N(OSC(F)(F)F)C2=O |
| InChI | InChI=1S/C16H12F3NO4S/c1-2-6-23-10-7-9-4-3-5-11-13(9)12(8-10)15(22)20(14(11)21)24-25-16(17,18)19/h3-5,7-8H,2,6H2,1H3 |
| InChIKey | RNUBNLFNCZKMLA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|