C20H16F3NO5S — CID 129270571
butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfanyloxy)benzo[de]isoquinolin-5-yl]prop-2-enoate (PubChem CID 129270571) has the molecular formula C20H16F3NO5S and a molecular weight of 439.41 g/mol. Its IUPAC name is butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfanyloxy)benzo[de]isoquinolin-5-yl]prop-2-enoate.
| Compound Name | butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfanyloxy)benzo[de]isoquinolin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 129270571 |
| Molecular Formula | C20H16F3NO5S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfanyloxy)benzo[de]isoquinolin-5-yl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1cc2c3c(cccc3c1)C(=O)N(OSC(F)(F)F)C2=O |
| InChI | InChI=1S/C20H16F3NO5S/c1-2-3-9-28-16(25)8-7-12-10-13-5-4-6-14-17(13)15(11-12)19(27)24(18(14)26)29-30-20(21,22)23/h4-8,10-11H,2-3,9H2,1H3/b8-7+ |
| InChIKey | QSVAUBRMFSAIIN-BQYQJAHWSA-N |
| XLogP | 4.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|