C20H12F3NO5S2 — CID 118968470
(6-benzylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate (PubChem CID 118968470) has the molecular formula C20H12F3NO5S2 and a molecular weight of 467.45 g/mol. Its IUPAC name is (6-benzylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate.
| Compound Name | (6-benzylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118968470 |
| Molecular Formula | C20H12F3NO5S2 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | (6-benzylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
| SMILES | O=C1c2cccc3c(SCc4ccccc4)ccc(c23)C(=O)N1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H12F3NO5S2/c21-20(22,23)31(27,28)29-24-18(25)14-8-4-7-13-16(10-9-15(17(13)14)19(24)26)30-11-12-5-2-1-3-6-12/h1-10H,11H2 |
| InChIKey | SMKJWEFKGAUCHA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|