C16H10F3NO5S2 — CID 118968461
(6-cyclopropylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate (PubChem CID 118968461) has the molecular formula C16H10F3NO5S2 and a molecular weight of 417.39 g/mol. Its IUPAC name is (6-cyclopropylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate.
| Compound Name | (6-cyclopropylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118968461 |
| Molecular Formula | C16H10F3NO5S2 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | (6-cyclopropylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
| SMILES | O=C1c2cccc3c(SC4CC4)ccc(c23)C(=O)N1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H10F3NO5S2/c17-16(18,19)27(23,24)25-20-14(21)10-3-1-2-9-12(26-8-4-5-8)7-6-11(13(9)10)15(20)22/h1-3,6-8H,4-5H2 |
| InChIKey | ZLHYOEZIFVAIIS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|