C22H22F3NO6S — CID 171051160
[6-[cyclohexyl(ethoxy)methyl]-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate (PubChem CID 171051160) has the molecular formula C22H22F3NO6S and a molecular weight of 485.48 g/mol. Its IUPAC name is [6-[cyclohexyl(ethoxy)methyl]-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-[cyclohexyl(ethoxy)methyl]-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171051160 |
| Molecular Formula | C22H22F3NO6S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | [6-[cyclohexyl(ethoxy)methyl]-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
| SMILES | CCOC(c1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O)C1CCCCC1 |
| InChI | InChI=1S/C22H22F3NO6S/c1-2-31-19(13-7-4-3-5-8-13)15-11-12-17-18-14(15)9-6-10-16(18)20(27)26(21(17)28)32-33(29,30)22(23,24)25/h6,9-13,19H,2-5,7-8H2,1H3 |
| InChIKey | CDTFYNINTQEVGH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|