C20H16F3NO6S — CID 122533845
[6-(3-butoxyprop-1-ynyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate (PubChem CID 122533845) has the molecular formula C20H16F3NO6S and a molecular weight of 455.41 g/mol. Its IUPAC name is [6-(3-butoxyprop-1-ynyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-(3-butoxyprop-1-ynyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122533845 |
| Molecular Formula | C20H16F3NO6S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | [6-(3-butoxyprop-1-ynyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
| SMILES | CCCCOCC#Cc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C20H16F3NO6S/c1-2-3-11-29-12-5-6-13-9-10-16-17-14(13)7-4-8-15(17)18(25)24(19(16)26)30-31(27,28)20(21,22)23/h4,7-10H,2-3,11-12H2,1H3 |
| InChIKey | JFIYQKHAUDULRS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|