C15H9F3N2O5S — CID 172703944
(1-oxo-3-phenoxyiminoisoindol-2-yl) trifluoromethanesulfonate (PubChem CID 172703944) has the molecular formula C15H9F3N2O5S and a molecular weight of 386.31 g/mol. Its IUPAC name is (1-oxo-3-phenoxyiminoisoindol-2-yl) trifluoromethanesulfonate.
| Compound Name | (1-oxo-3-phenoxyiminoisoindol-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 172703944 |
| Molecular Formula | C15H9F3N2O5S |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (1-oxo-3-phenoxyiminoisoindol-2-yl) trifluoromethanesulfonate |
| SMILES | O=C1c2ccccc2C(=NOc2ccccc2)N1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H9F3N2O5S/c16-15(17,18)26(22,23)25-20-13(19-24-10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(20)21/h1-9H |
| InChIKey | DIFIKGWMJWWELD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|