C12H8F5NO5S — CID 175863865
[1,1-dideuterio-3-(1,3-dioxoisoindol-2-yl)-2,2-difluoropropyl] trifluoromethanesulfonate (PubChem CID 175863865) has the molecular formula C12H8F5NO5S and a molecular weight of 375.27 g/mol. Its IUPAC name is [1,1-dideuterio-3-(1,3-dioxoisoindol-2-yl)-2,2-difluoropropyl] trifluoromethanesulfonate.
| Compound Name | [1,1-dideuterio-3-(1,3-dioxoisoindol-2-yl)-2,2-difluoropropyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175863865 |
| Molecular Formula | C12H8F5NO5S |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | [1,1-dideuterio-3-(1,3-dioxoisoindol-2-yl)-2,2-difluoropropyl] trifluoromethanesulfonate |
| SMILES | [2H]C([2H])(OS(=O)(=O)C(F)(F)F)C(F)(F)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H8F5NO5S/c13-11(14,6-23-24(21,22)12(15,16)17)5-18-9(19)7-3-1-2-4-8(7)10(18)20/h1-4H,5-6H2/i6D2 |
| InChIKey | XKWYEAUUECRUAE-NCYHJHSESA-N |
| XLogP | 1.78 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|