C13H12F3NO3 — CID 164683727
2-(4,4,4-trifluoro-2-hydroxy-2-methylbutyl)isoindole-1,3-dione (PubChem CID 164683727) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is 2-(4,4,4-trifluoro-2-hydroxy-2-methylbutyl)isoindole-1,3-dione.
| Compound Name | 2-(4,4,4-trifluoro-2-hydroxy-2-methylbutyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 164683727 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(4,4,4-trifluoro-2-hydroxy-2-methylbutyl)isoindole-1,3-dione |
| SMILES | CC(O)(CN1C(=O)c2ccccc2C1=O)CC(F)(F)F |
| InChI | InChI=1S/C13H12F3NO3/c1-12(20,6-13(14,15)16)7-17-10(18)8-4-2-3-5-9(8)11(17)19/h2-5,20H,6-7H2,1H3 |
| InChIKey | KIBZLDRKLUTRKN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|