C21H27N3O2 — CID 145497538
2-[2,2,4,4-tetramethyl-5-(5-methylimidazol-1-yl)pentyl]isoindole-1,3-dione (PubChem CID 145497538) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-[2,2,4,4-tetramethyl-5-(5-methylimidazol-1-yl)pentyl]isoindole-1,3-dione.
| Compound Name | 2-[2,2,4,4-tetramethyl-5-(5-methylimidazol-1-yl)pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 145497538 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 2-[2,2,4,4-tetramethyl-5-(5-methylimidazol-1-yl)pentyl]isoindole-1,3-dione |
| SMILES | Cc1cncn1CC(C)(C)CC(C)(C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H27N3O2/c1-15-10-22-14-23(15)12-20(2,3)11-21(4,5)13-24-18(25)16-8-6-7-9-17(16)19(24)26/h6-10,14H,11-13H2,1-5H3 |
| InChIKey | VOOXZCLUGMIYQB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|