C17H16N4O4 — CID 121121253
2-(1,3-dioxoisoindol-2-yl)-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]acetamide (PubChem CID 121121253) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 121121253 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]acetamide |
| SMILES | Cc1cncn(CCNC(=O)CN2C(=O)c3ccccc3C2=O)c1=O |
| InChI | InChI=1S/C17H16N4O4/c1-11-8-18-10-20(15(11)23)7-6-19-14(22)9-21-16(24)12-4-2-3-5-13(12)17(21)25/h2-5,8,10H,6-7,9H2,1H3,(H,19,22) |
| InChIKey | VLUFZSLNTCZVBW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|