C21H21N3O2 — CID 121121241
N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]-2,2-diphenylacetamide (PubChem CID 121121241) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 121121241 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]-2,2-diphenylacetamide |
| SMILES | Cc1cncn(CCNC(=O)C(c2ccccc2)c2ccccc2)c1=O |
| InChI | InChI=1S/C21H21N3O2/c1-16-14-22-15-24(21(16)26)13-12-23-20(25)19(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,14-15,19H,12-13H2,1H3,(H,23,25) |
| InChIKey | OBJWHIYMTUHQNL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |