C16H19NO5 — CID 830896
ethyl (2R)-4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate (PubChem CID 830896) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is ethyl (2R)-4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate.
| Compound Name | ethyl (2R)-4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 830896 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | ethyl (2R)-4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)[C@H](O)C(C)(C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H19NO5/c1-4-22-15(21)12(18)16(2,3)9-17-13(19)10-7-5-6-8-11(10)14(17)20/h5-8,12,18H,4,9H2,1-3H3/t12-/m0/s1 |
| InChIKey | QISBAMKCBKJWFV-LBPRGKRZSA-N |
| XLogP | 1.23 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|