C18H23NO5 — CID 84572845
ethyl 2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]butanoate (PubChem CID 84572845) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is ethyl 2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]butanoate.
| Compound Name | ethyl 2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]butanoate |
|---|---|
| PubChem CID | 84572845 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | ethyl 2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]butanoate |
| SMILES | CCOC(=O)C(CC)OCC(C)(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H23NO5/c1-5-14(17(22)23-6-2)24-11-18(3,4)19-15(20)12-9-7-8-10-13(12)16(19)21/h7-10,14H,5-6,11H2,1-4H3 |
| InChIKey | MKSQDFQPXWWMPX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|