C20H28N2O4 — CID 84572767
2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]-N,N-dipropylacetamide (PubChem CID 84572767) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]-N,N-dipropylacetamide.
| Compound Name | 2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 84572767 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)COCC(C)(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H28N2O4/c1-5-11-21(12-6-2)17(23)13-26-14-20(3,4)22-18(24)15-9-7-8-10-16(15)19(22)25/h7-10H,5-6,11-14H2,1-4H3 |
| InChIKey | AVYRXNRZDNLCKC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|