C18H23NO6 — CID 84572873
1-methoxypropan-2-yl 2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]acetate (PubChem CID 84572873) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]acetate.
| Compound Name | 1-methoxypropan-2-yl 2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]acetate |
|---|---|
| PubChem CID | 84572873 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1-methoxypropan-2-yl 2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]acetate |
| SMILES | COCC(C)OC(=O)COCC(C)(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H23NO6/c1-12(9-23-4)25-15(20)10-24-11-18(2,3)19-16(21)13-7-5-6-8-14(13)17(19)22/h5-8,12H,9-11H2,1-4H3 |
| InChIKey | XADJRRZWBRJMPB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|