C22H24N2O6 — CID 84572626
N-(2,5-dimethoxyphenyl)-2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]acetamide (PubChem CID 84572626) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]acetamide |
|---|---|
| PubChem CID | 84572626 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)COCC(C)(C)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C22H24N2O6/c1-22(2,24-20(26)15-7-5-6-8-16(15)21(24)27)13-30-12-19(25)23-17-11-14(28-3)9-10-18(17)29-4/h5-11H,12-13H2,1-4H3,(H,23,25) |
| InChIKey | KLNGGMJSLCIMDK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|