C26H32N2O6 — CID 84572834
N-[2-(3,4-diethoxyphenyl)ethyl]-2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]acetamide (PubChem CID 84572834) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]acetamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]acetamide |
|---|---|
| PubChem CID | 84572834 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[2-(1,3-dioxoisoindol-2-yl)-2-methylpropoxy]acetamide |
| SMILES | CCOc1ccc(CCNC(=O)COCC(C)(C)N2C(=O)c3ccccc3C2=O)cc1OCC |
| InChI | InChI=1S/C26H32N2O6/c1-5-33-21-12-11-18(15-22(21)34-6-2)13-14-27-23(29)16-32-17-26(3,4)28-24(30)19-9-7-8-10-20(19)25(28)31/h7-12,15H,5-6,13-14,16-17H2,1-4H3,(H,27,29) |
| InChIKey | OROUWGGZXQWXTA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|