C20H27N2O3+ — CID 8717630
N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2-methylpyridin-1-ium-1-yl)acetamide (PubChem CID 8717630) has the molecular formula C20H27N2O3+ and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2-methylpyridin-1-ium-1-yl)acetamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2-methylpyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8717630 |
| Molecular Formula | C20H27N2O3+ |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2-methylpyridin-1-ium-1-yl)acetamide |
| SMILES | CCOc1ccc(CCNC(=O)C[n+]2ccccc2C)cc1OCC |
| InChI | InChI=1S/C20H26N2O3/c1-4-24-18-10-9-17(14-19(18)25-5-2)11-12-21-20(23)15-22-13-7-6-8-16(22)3/h6-10,13-14H,4-5,11-12,15H2,1-3H3/p+1 |
| InChIKey | KFPJXOORHADSLM-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|