C26H23NO5 — CID 10550523
[2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate (PubChem CID 10550523) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate.
| Compound Name | [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 10550523 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate |
| SMILES | CC(C)(COC(=O)c1ccc(OCc2ccccc2)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H23NO5/c1-26(2,27-23(28)21-10-6-7-11-22(21)24(27)29)17-32-25(30)19-12-14-20(15-13-19)31-16-18-8-4-3-5-9-18/h3-15H,16-17H2,1-2H3 |
| InChIKey | WXTMELZPUQBTAY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|