About [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate
[2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate (PubChem CID 10550523) has the molecular formula C26H23NO5
and a molecular weight of 429.47 g/mol. Its IUPAC name is [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate |
| PubChem CID | 10550523 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate |
| SMILES | CC(C)(COC(=O)c1ccc(OCc2ccccc2)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H23NO5/c1-26(2,27-23(28)21-10-6-7-11-22(21)24(27)29)17-32-25(30)19-12-14-20(15-13-19)31-16-18-8-4-3-5-9-18/h3-15H,16-17H2,1-2H3 |
| InChIKey | WXTMELZPUQBTAY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate?
The IUPAC name of [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate (CID 10550523) is [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate.
What is the SMILES notation for [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate?
The canonical SMILES for [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate is CC(C)(COC(=O)c1ccc(OCc2ccccc2)cc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate?
The InChIKey is WXTMELZPUQBTAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23NO5/c1-26(2,27-23(28)21-10-6-7-11-22(21)24(27)29)17-32-25(30)19-12-14-20(15-13-19)31-16-18-8-4-3-5-9-18/h3-15H,16-17H2,1-2H3.
What are the key properties of [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate?
[2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate has a molecular weight of 429.47 g/mol, XLogP of 4.50, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-dioxoisoindol-2-yl)-2-methylpropyl] 4-phenylmethoxybenzoate is sourced from PubChem (CID 10550523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).