About acetamido 4-phenylmethoxybenzoate
acetamido 4-phenylmethoxybenzoate (PubChem CID 174287466) has the molecular formula C16H15NO4
and a molecular weight of 285.30 g/mol. Its IUPAC name is acetamido 4-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | acetamido 4-phenylmethoxybenzoate |
| PubChem CID | 174287466 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | acetamido 4-phenylmethoxybenzoate |
| SMILES | CC(=O)NOC(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H15NO4/c1-12(18)17-21-16(19)14-7-9-15(10-8-14)20-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,17,18) |
| InChIKey | YEAOCSRDZGHLOL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetamido 4-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamido 4-phenylmethoxybenzoate?
The IUPAC name of acetamido 4-phenylmethoxybenzoate (CID 174287466) is acetamido 4-phenylmethoxybenzoate.
What is the SMILES notation for acetamido 4-phenylmethoxybenzoate?
The canonical SMILES for acetamido 4-phenylmethoxybenzoate is CC(=O)NOC(=O)c1ccc(OCc2ccccc2)cc1.
What is the InChIKey of acetamido 4-phenylmethoxybenzoate?
The InChIKey is YEAOCSRDZGHLOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO4/c1-12(18)17-21-16(19)14-7-9-15(10-8-14)20-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,17,18).
What are the key properties of acetamido 4-phenylmethoxybenzoate?
acetamido 4-phenylmethoxybenzoate has a molecular weight of 285.30 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamido 4-phenylmethoxybenzoate is sourced from PubChem (CID 174287466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).