C16H17NO6 — CID 71517830
(2R)-4-(1,3-dioxoisoindol-2-yl)-2-ethoxycarbonyl-2-methylbutanoic acid (PubChem CID 71517830) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is (2R)-4-(1,3-dioxoisoindol-2-yl)-2-ethoxycarbonyl-2-methylbutanoic acid.
| Compound Name | (2R)-4-(1,3-dioxoisoindol-2-yl)-2-ethoxycarbonyl-2-methylbutanoic acid |
|---|---|
| PubChem CID | 71517830 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (2R)-4-(1,3-dioxoisoindol-2-yl)-2-ethoxycarbonyl-2-methylbutanoic acid |
| SMILES | CCOC(=O)[C@](C)(CCN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C16H17NO6/c1-3-23-15(22)16(2,14(20)21)8-9-17-12(18)10-6-4-5-7-11(10)13(17)19/h4-7H,3,8-9H2,1-2H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | RMJLLSXFFRCLIV-MRXNPFEDSA-N |
| XLogP | 1.33 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|