C12H15NO2Sn — CID 10426383
2-(trimethylstannylmethyl)isoindole-1,3-dione (PubChem CID 10426383) has the molecular formula C12H15NO2Sn and a molecular weight of 323.97 g/mol. Its IUPAC name is 2-(trimethylstannylmethyl)isoindole-1,3-dione.
| Compound Name | 2-(trimethylstannylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 10426383 |
| Molecular Formula | C12H15NO2Sn |
| Molecular Weight | 323.97 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 2-(trimethylstannylmethyl)isoindole-1,3-dione |
| SMILES | C[Sn](C)(C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C9H6NO2.3CH3.Sn/c1-10-8(11)6-4-2-3-5-7(6)9(10)12;;;;/h2-5H,1H2;3*1H3; |
| InChIKey | OXYZEICMLFXVFT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.97 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|