C18H19NO2Si — CID 15225532
2-[[benzyl(dimethyl)silyl]methyl]isoindole-1,3-dione (PubChem CID 15225532) has the molecular formula C18H19NO2Si and a molecular weight of 309.44 g/mol. Its IUPAC name is 2-[[benzyl(dimethyl)silyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[benzyl(dimethyl)silyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15225532 |
| Molecular Formula | C18H19NO2Si |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-[[benzyl(dimethyl)silyl]methyl]isoindole-1,3-dione |
| SMILES | C[Si](C)(Cc1ccccc1)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H19NO2Si/c1-22(2,12-14-8-4-3-5-9-14)13-19-17(20)15-10-6-7-11-16(15)18(19)21/h3-11H,12-13H2,1-2H3 |
| InChIKey | AINXKOKFDMEBKC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|