C17H16N2O5S — CID 24761681
[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropyl] sulfamate (PubChem CID 24761681) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is [2-(1,3-dioxoisoindol-2-yl)-3-phenylpropyl] sulfamate.
| Compound Name | [2-(1,3-dioxoisoindol-2-yl)-3-phenylpropyl] sulfamate |
|---|---|
| PubChem CID | 24761681 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [2-(1,3-dioxoisoindol-2-yl)-3-phenylpropyl] sulfamate |
| SMILES | NS(=O)(=O)OCC(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H16N2O5S/c18-25(22,23)24-11-13(10-12-6-2-1-3-7-12)19-16(20)14-8-4-5-9-15(14)17(19)21/h1-9,13H,10-11H2,(H2,18,22,23) |
| InChIKey | FKMRXVAUXMTCTH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|