C17H14NO4P — CID 70092565
2-(1-phenyl-3-phosphorosooxypropan-2-yl)isoindole-1,3-dione (PubChem CID 70092565) has the molecular formula C17H14NO4P and a molecular weight of 327.28 g/mol. Its IUPAC name is 2-(1-phenyl-3-phosphorosooxypropan-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(1-phenyl-3-phosphorosooxypropan-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 70092565 |
| Molecular Formula | C17H14NO4P |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-(1-phenyl-3-phosphorosooxypropan-2-yl)isoindole-1,3-dione |
| SMILES | O=POCC(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H14NO4P/c19-16-14-8-4-5-9-15(14)17(20)18(16)13(11-22-23-21)10-12-6-2-1-3-7-12/h1-9,13H,10-11H2 |
| InChIKey | RXAQCVRWBSBOBY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|