C20H20FNO3 — CID 14499625
2-(1-fluoro-5-phenylmethoxypentan-2-yl)isoindole-1,3-dione (PubChem CID 14499625) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-(1-fluoro-5-phenylmethoxypentan-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(1-fluoro-5-phenylmethoxypentan-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 14499625 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-(1-fluoro-5-phenylmethoxypentan-2-yl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C(CF)CCCOCc1ccccc1 |
| InChI | InChI=1S/C20H20FNO3/c21-13-16(9-6-12-25-14-15-7-2-1-3-8-15)22-19(23)17-10-4-5-11-18(17)20(22)24/h1-5,7-8,10-11,16H,6,9,12-14H2 |
| InChIKey | TWQUYDZTPMLBKH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|