C28H33NO5 — CID 167587358
tert-butyl (2S,6S)-6-(1,3-dioxoisoindol-2-yl)-4-oxo-7-phenyl-2-propan-2-ylheptanoate (PubChem CID 167587358) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is tert-butyl (2S,6S)-6-(1,3-dioxoisoindol-2-yl)-4-oxo-7-phenyl-2-propan-2-ylheptanoate.
| Compound Name | tert-butyl (2S,6S)-6-(1,3-dioxoisoindol-2-yl)-4-oxo-7-phenyl-2-propan-2-ylheptanoate |
|---|---|
| PubChem CID | 167587358 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | tert-butyl (2S,6S)-6-(1,3-dioxoisoindol-2-yl)-4-oxo-7-phenyl-2-propan-2-ylheptanoate |
| SMILES | CC(C)[C@H](CC(=O)C[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H33NO5/c1-18(2)24(27(33)34-28(3,4)5)17-21(30)16-20(15-19-11-7-6-8-12-19)29-25(31)22-13-9-10-14-23(22)26(29)32/h6-14,18,20,24H,15-17H2,1-5H3/t20-,24-/m0/s1 |
| InChIKey | AJAUTWZIWWWEDH-RDPSFJRHSA-N |
| XLogP | 4.86 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|