C26H22F3O5PS2 — CID 134976892
[benzenesulfonylmethyl(triphenyl)-λ5-phosphanyl] trifluoromethanesulfonate (PubChem CID 134976892) has the molecular formula C26H22F3O5PS2 and a molecular weight of 566.56 g/mol. Its IUPAC name is [benzenesulfonylmethyl(triphenyl)-λ5-phosphanyl] trifluoromethanesulfonate.
| Compound Name | [benzenesulfonylmethyl(triphenyl)-λ5-phosphanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134976892 |
| Molecular Formula | C26H22F3O5PS2 |
| Molecular Weight | 566.56 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | [benzenesulfonylmethyl(triphenyl)-λ5-phosphanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(CP(OS(=O)(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H22F3O5PS2/c27-26(28,29)37(32,33)34-35(22-13-5-1-6-14-22,23-15-7-2-8-16-23,24-17-9-3-10-18-24)21-36(30,31)25-19-11-4-12-20-25/h1-20H,21H2 |
| InChIKey | XDRRPXXEWNDTSC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|