C38H30F6O6S4 — CID 141079280
(triphenyl-λ4-sulfanyl) trifluoromethanesulfonate (PubChem CID 141079280) has the molecular formula C38H30F6O6S4 and a molecular weight of 824.91 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) trifluoromethanesulfonate.
| Compound Name | (triphenyl-λ4-sulfanyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 141079280 |
| Molecular Formula | C38H30F6O6S4 |
| Molecular Weight | 824.91 g/mol |
| Exact Mass | 824.08 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F.O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/2C19H15F3O3S2/c2*20-19(21,22)27(23,24)25-26(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h2*1-15H |
| InChIKey | QPYMMAMDIBXTAA-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.91 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|