C22H21F3O3S2 — CID 171490683
(triphenyl-λ4-sulfanyl) 1,1,2-trifluorobutane-1-sulfonate (PubChem CID 171490683) has the molecular formula C22H21F3O3S2 and a molecular weight of 454.54 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 1,1,2-trifluorobutane-1-sulfonate.
| Compound Name | (triphenyl-λ4-sulfanyl) 1,1,2-trifluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 171490683 |
| Molecular Formula | C22H21F3O3S2 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 1,1,2-trifluorobutane-1-sulfonate |
| SMILES | CCC(F)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21F3O3S2/c1-2-21(23)22(24,25)30(26,27)28-29(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17,21H,2H2,1H3 |
| InChIKey | XKZNSPWDSJOEQH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |