C30H31ClF6O5S2 — CID 87124090
5-(chloromethyl)heptyl 3,3,3-trifluoro-2-(trifluoromethyl)-2-(triphenyl-λ4-sulfanyl)oxysulfonylpropanoate (PubChem CID 87124090) has the molecular formula C30H31ClF6O5S2 and a molecular weight of 685.15 g/mol. Its IUPAC name is 5-(chloromethyl)heptyl 3,3,3-trifluoro-2-(trifluoromethyl)-2-(triphenyl-λ4-sulfanyl)oxysulfonylpropanoate.
| Compound Name | 5-(chloromethyl)heptyl 3,3,3-trifluoro-2-(trifluoromethyl)-2-(triphenyl-λ4-sulfanyl)oxysulfonylpropanoate |
|---|---|
| PubChem CID | 87124090 |
| Molecular Formula | C30H31ClF6O5S2 |
| Molecular Weight | 685.15 g/mol |
| Exact Mass | 684.12 |
| IUPAC Name | 5-(chloromethyl)heptyl 3,3,3-trifluoro-2-(trifluoromethyl)-2-(triphenyl-λ4-sulfanyl)oxysulfonylpropanoate |
| SMILES | CCC(CCl)CCCCOC(=O)C(C(F)(F)F)(C(F)(F)F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H31ClF6O5S2/c1-2-23(22-31)14-12-13-21-41-27(38)28(29(32,33)34,30(35,36)37)44(39,40)42-43(24-15-6-3-7-16-24,25-17-8-4-9-18-25)26-19-10-5-11-20-26/h3-11,15-20,23H,2,12-14,21-22H2,1H3 |
| InChIKey | KHKLNDBGTAMZBX-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.15 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|