C29H35F3O3S2 — CID 139924156
[[4-(2-ethylhexyl)phenyl]-bis(4-methylphenyl)-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 139924156) has the molecular formula C29H35F3O3S2 and a molecular weight of 552.72 g/mol. Its IUPAC name is [[4-(2-ethylhexyl)phenyl]-bis(4-methylphenyl)-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [[4-(2-ethylhexyl)phenyl]-bis(4-methylphenyl)-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139924156 |
| Molecular Formula | C29H35F3O3S2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | [[4-(2-ethylhexyl)phenyl]-bis(4-methylphenyl)-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CCCCC(CC)Cc1ccc(S(OS(=O)(=O)C(F)(F)F)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H35F3O3S2/c1-5-7-8-24(6-2)21-25-13-19-28(20-14-25)36(26-15-9-22(3)10-16-26,27-17-11-23(4)12-18-27)35-37(33,34)29(30,31)32/h9-20,24H,5-8,21H2,1-4H3 |
| InChIKey | PVJKFGUKOZXPHR-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|