C29H35F3O5S2 — CID 139700220
[[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-bis(4-methylphenyl)-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 139700220) has the molecular formula C29H35F3O5S2 and a molecular weight of 584.72 g/mol. Its IUPAC name is [[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-bis(4-methylphenyl)-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-bis(4-methylphenyl)-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139700220 |
| Molecular Formula | C29H35F3O5S2 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | [[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-bis(4-methylphenyl)-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(S(OS(=O)(=O)C(F)(F)F)(c2ccc(C)cc2)c2ccc(OC(C)(C)C)c(OC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C29H35F3O5S2/c1-20-9-13-22(14-10-20)38(23-15-11-21(2)12-16-23,37-39(33,34)29(30,31)32)24-17-18-25(35-27(3,4)5)26(19-24)36-28(6,7)8/h9-19H,1-8H3 |
| InChIKey | WYIXOUJKSZSFHU-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|