C29H36F3NO5S2 — CID 57061462
[[4-(dimethylamino)phenyl]-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 57061462) has the molecular formula C29H36F3NO5S2 and a molecular weight of 599.74 g/mol. Its IUPAC name is [[4-(dimethylamino)phenyl]-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [[4-(dimethylamino)phenyl]-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57061462 |
| Molecular Formula | C29H36F3NO5S2 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | [[4-(dimethylamino)phenyl]-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CN(C)c1ccc(S(OS(=O)(=O)C(F)(F)F)(c2ccc(OC(C)(C)C)cc2)c2ccc(OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H36F3NO5S2/c1-27(2,3)36-22-11-17-25(18-12-22)39(38-40(34,35)29(30,31)32,24-15-9-21(10-16-24)33(7)8)26-19-13-23(14-20-26)37-28(4,5)6/h9-20H,1-8H3 |
| InChIKey | WTFVFVHCFDINPM-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|