C22H21F3O4S4 — CID 178004081
[(4-methoxyphenyl)-bis(3-methylsulfanylphenyl)-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 178004081) has the molecular formula C22H21F3O4S4 and a molecular weight of 534.67 g/mol. Its IUPAC name is [(4-methoxyphenyl)-bis(3-methylsulfanylphenyl)-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [(4-methoxyphenyl)-bis(3-methylsulfanylphenyl)-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 178004081 |
| Molecular Formula | C22H21F3O4S4 |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | [(4-methoxyphenyl)-bis(3-methylsulfanylphenyl)-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(S(OS(=O)(=O)C(F)(F)F)(c2cccc(SC)c2)c2cccc(SC)c2)cc1 |
| InChI | InChI=1S/C22H21F3O4S4/c1-28-16-10-12-19(13-11-16)32(29-33(26,27)22(23,24)25,20-8-4-6-17(14-20)30-2)21-9-5-7-18(15-21)31-3/h4-15H,1-3H3 |
| InChIKey | BNTJKFAWBXMACP-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|