C21H20F3O5S2+ — CID 91040883
[bis(4-methoxyphenyl)-phenyl-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium (PubChem CID 91040883) has the molecular formula C21H20F3O5S2+ and a molecular weight of 473.51 g/mol. Its IUPAC name is [bis(4-methoxyphenyl)-phenyl-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium.
| Compound Name | [bis(4-methoxyphenyl)-phenyl-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
|---|---|
| PubChem CID | 91040883 |
| Molecular Formula | C21H20F3O5S2+ |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | [bis(4-methoxyphenyl)-phenyl-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
| SMILES | COc1ccc(S([OH+]S(=O)(=O)C(F)(F)F)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H19F3O5S2/c1-27-16-8-12-19(13-9-16)30(18-6-4-3-5-7-18,29-31(25,26)21(22,23)24)20-14-10-17(28-2)11-15-20/h3-15H,1-2H3/p+1 |
| InChIKey | LWLJLZRFFYBDGU-UHFFFAOYSA-O |
| XLogP | 5.84 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|