C26H22F3O4S2+ — CID 158808979
(4-methoxyphenyl)-diphenylsulfanium;trifluoromethyl benzenesulfonate (PubChem CID 158808979) has the molecular formula C26H22F3O4S2+ and a molecular weight of 519.59 g/mol. Its IUPAC name is (4-methoxyphenyl)-diphenylsulfanium;trifluoromethyl benzenesulfonate.
| Compound Name | (4-methoxyphenyl)-diphenylsulfanium;trifluoromethyl benzenesulfonate |
|---|---|
| PubChem CID | 158808979 |
| Molecular Formula | C26H22F3O4S2+ |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | (4-methoxyphenyl)-diphenylsulfanium;trifluoromethyl benzenesulfonate |
| SMILES | COc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S(=O)(OC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H17OS.C7H5F3O3S/c1-20-16-12-14-19(15-13-16)21(17-8-4-2-5-9-17)18-10-6-3-7-11-18;8-7(9,10)13-14(11,12)6-4-2-1-3-5-6/h2-15H,1H3;1-5H/q+1; |
| InChIKey | IUKYZCSWFVYZGC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|