About trityl 4-methoxybenzenesulfonate
trityl 4-methoxybenzenesulfonate (PubChem CID 139948091) has the molecular formula C26H22O4S
and a molecular weight of 430.53 g/mol. Its IUPAC name is trityl 4-methoxybenzenesulfonate.
Molecular Properties
| Compound Name | trityl 4-methoxybenzenesulfonate |
| PubChem CID | 139948091 |
| Molecular Formula | C26H22O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | trityl 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)OC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22O4S/c1-29-24-17-19-25(20-18-24)31(27,28)30-26(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-20H,1H3 |
| InChIKey | LHSQECQZHYRNFZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze trityl 4-methoxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trityl 4-methoxybenzenesulfonate?
The IUPAC name of trityl 4-methoxybenzenesulfonate (CID 139948091) is trityl 4-methoxybenzenesulfonate.
What is the SMILES notation for trityl 4-methoxybenzenesulfonate?
The canonical SMILES for trityl 4-methoxybenzenesulfonate is COc1ccc(S(=O)(=O)OC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of trityl 4-methoxybenzenesulfonate?
The InChIKey is LHSQECQZHYRNFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22O4S/c1-29-24-17-19-25(20-18-24)31(27,28)30-26(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-20H,1H3.
What are the key properties of trityl 4-methoxybenzenesulfonate?
trityl 4-methoxybenzenesulfonate has a molecular weight of 430.53 g/mol, XLogP of 5.39, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trityl 4-methoxybenzenesulfonate is sourced from PubChem (CID 139948091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).