C26H30O6S — CID 151825288
4-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-yl methanesulfonate (PubChem CID 151825288) has the molecular formula C26H30O6S and a molecular weight of 470.59 g/mol. Its IUPAC name is 4-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-yl methanesulfonate.
| Compound Name | 4-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-yl methanesulfonate |
|---|---|
| PubChem CID | 151825288 |
| Molecular Formula | C26H30O6S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 4-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-yl methanesulfonate |
| SMILES | COc1ccc(C(OCCC(C)OS(C)(=O)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H30O6S/c1-20(32-33(4,27)28)18-19-31-26(21-8-6-5-7-9-21,22-10-14-24(29-2)15-11-22)23-12-16-25(30-3)17-13-23/h5-17,20H,18-19H2,1-4H3 |
| InChIKey | SDMCOCUNSBKJOW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|