C29H32O9S — CID 67765095
2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethylsulfonyl]ethyl]butanedioic acid (PubChem CID 67765095) has the molecular formula C29H32O9S and a molecular weight of 556.63 g/mol. Its IUPAC name is 2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethylsulfonyl]ethyl]butanedioic acid.
| Compound Name | 2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethylsulfonyl]ethyl]butanedioic acid |
|---|---|
| PubChem CID | 67765095 |
| Molecular Formula | C29H32O9S |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethylsulfonyl]ethyl]butanedioic acid |
| SMILES | COc1ccc(C(OCCS(=O)(=O)CCC(CC(=O)O)C(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H32O9S/c1-36-25-12-8-23(9-13-25)29(22-6-4-3-5-7-22,24-10-14-26(37-2)15-11-24)38-17-19-39(34,35)18-16-21(28(32)33)20-27(30)31/h3-15,21H,16-20H2,1-2H3,(H,30,31)(H,32,33) |
| InChIKey | OVXKHXDTDMPUPI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|