C28H33NO7 — CID 146036636
4-amino-3-[2-[tris(4-methoxyphenyl)methoxy]ethoxy]butanoic acid (PubChem CID 146036636) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is 4-amino-3-[2-[tris(4-methoxyphenyl)methoxy]ethoxy]butanoic acid.
| Compound Name | 4-amino-3-[2-[tris(4-methoxyphenyl)methoxy]ethoxy]butanoic acid |
|---|---|
| PubChem CID | 146036636 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 4-amino-3-[2-[tris(4-methoxyphenyl)methoxy]ethoxy]butanoic acid |
| SMILES | COc1ccc(C(OCCOC(CN)CC(=O)O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H33NO7/c1-32-23-10-4-20(5-11-23)28(21-6-12-24(33-2)13-7-21,22-8-14-25(34-3)15-9-22)36-17-16-35-26(19-29)18-27(30)31/h4-15,26H,16-19,29H2,1-3H3,(H,30,31) |
| InChIKey | QQEMRDWNNCNCMM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|